Products 1033600-38-2

CAS 1033600-38-2 is the registry number for 2-(1-(3-Methylbut-2-en-1-yl)-3-oxopiperazin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[1-(3-methylbut-2-enyl)-3-oxopiperazin-2-yl]acetic acid (CAS 1033600-38-2) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: 2-[1-(3-methylbut-2-enyl)-3-oxopiperazin-2-yl]acetic acid. InChIKey: MARIFOWYUTYWLP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18N2O3
Molecular weight226.27 g/mol
IUPAC name2-[1-(3-methylbut-2-enyl)-3-oxopiperazin-2-yl]acetic acid
InChIKeyMARIFOWYUTYWLP-UHFFFAOYSA-N
SMILESCC(=CCN1CCNC(=O)C1CC(=O)O)C

Computed by PubChem (NCBI)