CAS 1033805-74-1 is the registry number for 2'-Bromo-5'-chloro-2,2,2-trifluoroacetophenone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-bromo-5-chlorophenyl)-2,2,2-trifluoroethanone (CAS 1033805-74-1) is a chemical compound with the molecular formula C8H3BrClF3O and a molecular weight of 287.46 g/mol. IUPAC name: 1-(2-bromo-5-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: VEUFYHFPYCXIOR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O |
|---|---|
| Molecular weight | 287.46 g/mol |
| IUPAC name | 1-(2-bromo-5-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | VEUFYHFPYCXIOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)