CAS 104356-17-4 appears in our catalog under these names: 4–Bromo–2–(trifluoromethyl)benzoyl Chloride, 4-Bromo-2-(trifluoromethyl)benzoyl chloride, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 100g, 25g.
4-bromo-2-(trifluoromethyl)benzoyl chloride (CAS 104356-17-4) is a chemical compound with the molecular formula C8H3BrClF3O and a molecular weight of 287.46 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)benzoyl chloride. InChIKey: SPIPCSMQAATVLA-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O |
|---|---|
| Molecular weight | 287.46 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)benzoyl chloride |
| InChIKey | SPIPCSMQAATVLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)