CAS 886502-80-3 appears in our catalog under these names: 2'-Bromo-6'-chloro-2,2,2-trifluoro acetophenone, 95%, 1-(2-Bromo-6-chlorophenyl)-2,2,2-trifluoroethan-1-one, 96%, 2'-Bromo-6'-chloro-2,2,2-trifluoroacetophenone, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 25g, 5g.
1-(2-bromo-6-chlorophenyl)-2,2,2-trifluoroethanone (CAS 886502-80-3) is a chemical compound with the molecular formula C8H3BrClF3O and a molecular weight of 287.46 g/mol. IUPAC name: 1-(2-bromo-6-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: XUDVGQSZJCOUMM-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O |
|---|---|
| Molecular weight | 287.46 g/mol |
| IUPAC name | 1-(2-bromo-6-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | XUDVGQSZJCOUMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)