Products 944836-48-0
CAS 944836-48-0 appears in our catalog under these names: 2-Bromo-5-(trifluoromethyl)benzoyl chloride, 95%, 2-Bromo-5-(trifluoromethyl)benzoyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-bromo-5-(trifluoromethyl)benzoyl chloride (CAS 944836-48-0) is a chemical compound with the molecular formula C8H3BrClF3O and a molecular weight of 287.46 g/mol. IUPAC name: 2-bromo-5-(trifluoromethyl)benzoyl chloride. InChIKey: JBGOJVKABOQRFR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O |
|---|---|
| Molecular weight | 287.46 g/mol |
| IUPAC name | 2-bromo-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | JBGOJVKABOQRFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)Br |
Computed by PubChem (NCBI)