CAS 1034057-93-6 appears in our catalog under these names: Benzyl n-[(3s,4r)-3-fluoropiperidin-4-yl]carbamate hydrochloride, 95%, Benzyl ((3S,4R)-3-fluoropiperidin-4-yl)carbamate hydrochloride, 95+%, Benzyl n-[(3s,4r)-3-fluoropiperidin-4-yl]carbamate hydrochloride, 97%, 97%, Benzyl ((3S,4R)-3-fluoropiperidin-4-yl)carbamate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
Benzyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate;hydrochloride (CAS 1034057-93-6) is a chemical compound with the molecular formula C13H18ClFN2O2 and a molecular weight of 288.74 g/mol. IUPAC name: benzyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate;hydrochloride. InChIKey: ZKCOORKLTLUZCC-ZVWHLABXSA-N.
| Molecular formula | C13H18ClFN2O2 |
|---|---|
| Molecular weight | 288.74 g/mol |
| IUPAC name | benzyl N-[(3S,4R)-3-fluoropiperidin-4-yl]carbamate;hydrochloride |
| InChIKey | ZKCOORKLTLUZCC-ZVWHLABXSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1NC(=O)OCC2=CC=CC=C2)F.Cl |
Computed by PubChem (NCBI)