Products 1638744-94-1
CAS 1638744-94-1 is the registry number for Benzyl n-[(3s,4s)-3-fluoropiperidin-4-yl]carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate;hydrochloride (CAS 1638744-94-1) is a chemical compound with the molecular formula C13H18ClFN2O2 and a molecular weight of 288.74 g/mol. IUPAC name: benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate;hydrochloride. InChIKey: ZKCOORKLTLUZCC-FXMYHANSSA-N.
| Molecular formula | C13H18ClFN2O2 |
|---|---|
| Molecular weight | 288.74 g/mol |
| IUPAC name | benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate;hydrochloride |
| InChIKey | ZKCOORKLTLUZCC-FXMYHANSSA-N |
| SMILES | C1CNC[C@@H]([C@H]1NC(=O)OCC2=CC=CC=C2)F.Cl |
Computed by PubChem (NCBI)