Products 1951444-35-1
CAS 1951444-35-1 is the registry number for Trans-benzyl 4-amino-3-fluoropiperidine-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride (CAS 1951444-35-1) is a chemical compound with the molecular formula C13H18ClFN2O2 and a molecular weight of 288.74 g/mol. IUPAC name: benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride. InChIKey: CVDZOJLGFLYIMX-FXMYHANSSA-N.
| Molecular formula | C13H18ClFN2O2 |
|---|---|
| Molecular weight | 288.74 g/mol |
| IUPAC name | benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride |
| InChIKey | CVDZOJLGFLYIMX-FXMYHANSSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1N)F)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)