Products 2007909-86-4

CAS 2007909-86-4 is the registry number for Benzyl ((3,5-cis)-5-fluoropiperidin-3-yl)carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(3R,5S)-5-fluoropiperidin-3-yl]carbamate;hydrochloride (CAS 2007909-86-4) is a chemical compound with the molecular formula C13H18ClFN2O2 and a molecular weight of 288.74 g/mol. IUPAC name: benzyl N-[(3R,5S)-5-fluoropiperidin-3-yl]carbamate;hydrochloride. InChIKey: RZLXUSRNOIRNLG-ZVWHLABXSA-N.

Identity
Molecular formulaC13H18ClFN2O2
Molecular weight288.74 g/mol
IUPAC namebenzyl N-[(3R,5S)-5-fluoropiperidin-3-yl]carbamate;hydrochloride
InChIKeyRZLXUSRNOIRNLG-ZVWHLABXSA-N
SMILESC1[C@H](CNC[C@H]1F)NC(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)