CAS 1034188-31-2 appears in our catalog under these names: 2-(Trifluoromethyl)-2',3',4',5'-tetrahydro-(1,1'-biphenyl)-4-carboxylic acid, 98%, 4-(Cyclohex-1-en-1-yl)-3-(trifluoromethyl)benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.
4-(cyclohexen-1-yl)-3-(trifluoromethyl)benzoic acid (CAS 1034188-31-2) is a chemical compound with the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. IUPAC name: 4-(cyclohexen-1-yl)-3-(trifluoromethyl)benzoic acid. InChIKey: GBPKMRHYCIDENN-UHFFFAOYSA-N.
| Molecular formula | C14H13F3O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 4-(cyclohexen-1-yl)-3-(trifluoromethyl)benzoic acid |
| InChIKey | GBPKMRHYCIDENN-UHFFFAOYSA-N |
| SMILES | C1CCC(=CC1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)