CAS 2351201-09-5 is the registry number for 6-(Trifluoromethyl)-2H-spiro[benzofuran-3,1'-cyclohexan]-4'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-one (CAS 2351201-09-5) is a chemical compound with the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-one. InChIKey: NVJGRMKFMQLVSX-UHFFFAOYSA-N.
| Molecular formula | C14H13F3O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-cyclohexane]-1'-one |
| InChIKey | NVJGRMKFMQLVSX-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1=O)COC3=C2C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)