Products 2219380-08-0

CAS 2219380-08-0 is the registry number for 1-(4-(Trifluoromethyl)phenyl)bicyclo[2.1.1]hexane-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-[4-(trifluoromethyl)phenyl]bicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2219380-08-0) is a chemical compound with the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]bicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: FOGPQGGRXATHKG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13F3O2
Molecular weight270.25 g/mol
IUPAC name1-[4-(trifluoromethyl)phenyl]bicyclo[2.1.1]hexane-5-carboxylic acid
InChIKeyFOGPQGGRXATHKG-UHFFFAOYSA-N
SMILESC1CC2(CC1C2C(=O)O)C3=CC=C(C=C3)C(F)(F)F

Computed by PubChem (NCBI)