CAS 2074610-52-7 is the registry number for Methyl 3-(4-(trifluoromethyl)phenyl)bicyclo(1.1.1)pentane-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
Methyl 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylate (CAS 2074610-52-7) is a chemical compound with the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. IUPAC name: methyl 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylate. InChIKey: PSHFNAYZZNWMGH-UHFFFAOYSA-N.
| Molecular formula | C14H13F3O2 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | methyl 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | PSHFNAYZZNWMGH-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)