CAS 1034248-85-5 is the registry number for 4-Ethoxy-2-fluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-ethoxy-2-fluorobenzoyl chloride (CAS 1034248-85-5) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 4-ethoxy-2-fluorobenzoyl chloride. InChIKey: FTJONAPGITZXSQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 4-ethoxy-2-fluorobenzoyl chloride |
| InChIKey | FTJONAPGITZXSQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)C(=O)Cl)F |
Computed by PubChem (NCBI)