Products 1034248-85-5

CAS 1034248-85-5 is the registry number for 4-Ethoxy-2-fluorobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-ethoxy-2-fluorobenzoyl chloride (CAS 1034248-85-5) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 4-ethoxy-2-fluorobenzoyl chloride. InChIKey: FTJONAPGITZXSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClFO2
Molecular weight202.61 g/mol
IUPAC name4-ethoxy-2-fluorobenzoyl chloride
InChIKeyFTJONAPGITZXSQ-UHFFFAOYSA-N
SMILESCCOC1=CC(=C(C=C1)C(=O)Cl)F

Computed by PubChem (NCBI)