Products 103450-96-0
CAS 103450-96-0 is the registry number for Xanthone V1a. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,5,6-tetrahydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one (CAS 103450-96-0) is a chemical compound with the molecular formula C23H24O6 and a molecular weight of 396.4 g/mol. IUPAC name: 1,3,5,6-tetrahydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one. InChIKey: RPRBDJMEDUZWHP-UHFFFAOYSA-N.
| Molecular formula | C23H24O6 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 1,3,5,6-tetrahydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | RPRBDJMEDUZWHP-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C(=C(C=C3)O)O)CC=C(C)C)O)C |
Computed by PubChem (NCBI)