CAS 1034921-55-5 appears in our catalog under these names: 3,3-Difluoro-2,2-dimethyl-1-indanone, 95%, 3,3–Difluoro–2,2–dimethyl–1–indanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
3,3-difluoro-2,2-dimethylinden-1-one (CAS 1034921-55-5) is a chemical compound with the molecular formula C11H10F2O and a molecular weight of 196.19 g/mol. IUPAC name: 3,3-difluoro-2,2-dimethylinden-1-one. InChIKey: UNFRJPPMTNOXKL-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 3,3-difluoro-2,2-dimethylinden-1-one |
| InChIKey | UNFRJPPMTNOXKL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2=CC=CC=C2C1(F)F)C |
Computed by PubChem (NCBI)