CAS 77263-65-1 is the registry number for 4,7-Difluoro-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-difluoro-3,3-dimethyl-2H-inden-1-one (CAS 77263-65-1) is a chemical compound with the molecular formula C11H10F2O and a molecular weight of 196.19 g/mol. IUPAC name: 4,7-difluoro-3,3-dimethyl-2H-inden-1-one. InChIKey: FPTSVKRXAPBNOQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 4,7-difluoro-3,3-dimethyl-2H-inden-1-one |
| InChIKey | FPTSVKRXAPBNOQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(C=CC(=C21)F)F)C |
Computed by PubChem (NCBI)