CAS 1779810-61-5 is the registry number for 1-(1,1-Difluoro-2,3-dihydro-1H-inden-4-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanone (CAS 1779810-61-5) is a chemical compound with the molecular formula C11H10F2O and a molecular weight of 196.19 g/mol. IUPAC name: 1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanone. InChIKey: NRJBPPGHRHNTRX-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 1-(1,1-difluoro-2,3-dihydroinden-4-yl)ethanone |
| InChIKey | NRJBPPGHRHNTRX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2CCC(C2=CC=C1)(F)F |
Computed by PubChem (NCBI)