CAS 874279-88-6 appears in our catalog under these names: 6,6-Difluoro-6,7,8,9-tetrahydro-5h-benzo(7)annulen-5-one, 95%, 6,6-Difluoro-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6,6-difluoro-8,9-dihydro-7H-benzo[7]annulen-5-one (CAS 874279-88-6) is a chemical compound with the molecular formula C11H10F2O and a molecular weight of 196.19 g/mol. IUPAC name: 6,6-difluoro-8,9-dihydro-7H-benzo[7]annulen-5-one. InChIKey: XKIOHCHHAWSCTB-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O |
|---|---|
| Molecular weight | 196.19 g/mol |
| IUPAC name | 6,6-difluoro-8,9-dihydro-7H-benzo[7]annulen-5-one |
| InChIKey | XKIOHCHHAWSCTB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(=O)C(C1)(F)F |
Computed by PubChem (NCBI)