Products 1035235-21-2
CAS 1035235-21-2 appears in our catalog under these names: 2-Bromo-5-(dimethylamino)benzoic acid, 2-Bromo-5-(dimethylamino)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 10g, 5g, 1g.
2-bromo-5-(dimethylamino)benzoic acid (CAS 1035235-21-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-bromo-5-(dimethylamino)benzoic acid. InChIKey: HICSXUAAJBEMKP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-bromo-5-(dimethylamino)benzoic acid |
| InChIKey | HICSXUAAJBEMKP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)