Products 1035840-25-5
CAS 1035840-25-5 appears in our catalog under these names: 6-Chloro-2-(1,4-diazepan-1-yl)-1,3-benzoxazole, 95%, 6-Chloro-2-(1,4-diazepan-1-yl)benzo(d)oxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-chloro-2-(1,4-diazepan-1-yl)-1,3-benzoxazole (CAS 1035840-25-5) is a chemical compound with the molecular formula C12H14ClN3O and a molecular weight of 251.71 g/mol. IUPAC name: 6-chloro-2-(1,4-diazepan-1-yl)-1,3-benzoxazole. InChIKey: UOYWZGNXQWELDK-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 6-chloro-2-(1,4-diazepan-1-yl)-1,3-benzoxazole |
| InChIKey | UOYWZGNXQWELDK-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)