CAS 1306603-44-0 appears in our catalog under these names: (5-Cyclopropyl-1,2,4-oxadiazol-3-yl)(phenyl)methanamine hydrochloride, 95%, 1-(5-Cyclopropyl-1,2,4-oxadiazol-3-yl)-1-phenylmethanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-phenylmethanamine;hydrochloride (CAS 1306603-44-0) is a chemical compound with the molecular formula C12H14ClN3O and a molecular weight of 251.71 g/mol. IUPAC name: (5-cyclopropyl-1,2,4-oxadiazol-3-yl)-phenylmethanamine;hydrochloride. InChIKey: GRVMESQSBHHRHT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (5-cyclopropyl-1,2,4-oxadiazol-3-yl)-phenylmethanamine;hydrochloride |
| InChIKey | GRVMESQSBHHRHT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NO2)C(C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)