CAS 1196154-72-9 is the registry number for 3-Phenyl-5-(pyrrolidin-2-yl)-1,2,4-oxadiazole hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole;hydrochloride (CAS 1196154-72-9) is a chemical compound with the molecular formula C12H14ClN3O and a molecular weight of 251.71 g/mol. IUPAC name: 3-phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole;hydrochloride. InChIKey: BGLZSWCTBHMPCE-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 3-phenyl-5-pyrrolidin-2-yl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | BGLZSWCTBHMPCE-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=NC(=NO2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)