CAS 1373233-51-2 is the registry number for 4-[5-(1-Chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]aniline (CAS 1373233-51-2) is a chemical compound with the molecular formula C12H14ClN3O and a molecular weight of 251.71 g/mol. IUPAC name: 4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: VHKQRVDCFPITCT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | VHKQRVDCFPITCT-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C1=NC(=NO1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)