CAS 1035840-57-3 is the registry number for [1-(5-Chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetic acid (CAS 1035840-57-3) is a chemical compound with the molecular formula C14H15ClN2O3 and a molecular weight of 294.73 g/mol. IUPAC name: 2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetic acid. InChIKey: DZFLGFKFCANZLM-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O3 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | 2-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-3-yl]acetic acid |
| InChIKey | DZFLGFKFCANZLM-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC3=C(O2)C=CC(=C3)Cl)CC(=O)O |
Computed by PubChem (NCBI)