Products 2140326-75-4
CAS 2140326-75-4 is the registry number for tert-Butyl N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]carbamate (CAS 2140326-75-4) is a chemical compound with the molecular formula C14H15ClN2O3 and a molecular weight of 294.73 g/mol. IUPAC name: tert-butyl N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]carbamate. InChIKey: JPPFYDRGNRTVDI-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O3 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | tert-butyl N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]carbamate |
| InChIKey | JPPFYDRGNRTVDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)C2=CN=CO2 |
Computed by PubChem (NCBI)