CAS 185750-07-6 appears in our catalog under these names: Methyl tryptophan Impurity 1, (R)-Methyl 2-(2-chloroacetamido)-3-(1H-indol-3-yl)propanoate, 95%, Tadalafil Impurity 38, Tadalafil Impurity 26. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2R)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate (CAS 185750-07-6) is a chemical compound with the molecular formula C14H15ClN2O3 and a molecular weight of 294.73 g/mol. IUPAC name: methyl (2R)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate. InChIKey: KDURQOJTVSURJA-GFCCVEGCSA-N.
| Molecular formula | C14H15ClN2O3 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | methyl (2R)-2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoate |
| InChIKey | KDURQOJTVSURJA-GFCCVEGCSA-N |
| SMILES | COC(=O)[C@@H](CC1=CNC2=CC=CC=C21)NC(=O)CCl |
Computed by PubChem (NCBI)