CAS 1235280-35-9 appears in our catalog under these names: (R)-N-Acetyl-6-chloro-trp-ome, 95%, (R)–N–Acetyl–6–Chloro–Trp–OMe. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg.
Methyl (2R)-2-acetamido-3-(6-chloro-1H-indol-3-yl)propanoate (CAS 1235280-35-9) is a chemical compound with the molecular formula C14H15ClN2O3 and a molecular weight of 294.73 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-(6-chloro-1H-indol-3-yl)propanoate. InChIKey: WADYMQMUSHRFED-CYBMUJFWSA-N.
| Molecular formula | C14H15ClN2O3 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-(6-chloro-1H-indol-3-yl)propanoate |
| InChIKey | WADYMQMUSHRFED-CYBMUJFWSA-N |
| SMILES | CC(=O)N[C@H](CC1=CNC2=C1C=CC(=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)