CAS 1035994-36-5 is the registry number for 4-(Bromomethyl)-6,7-dimethoxyquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-6,7-dimethoxyquinazoline (CAS 1035994-36-5) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 4-(bromomethyl)-6,7-dimethoxyquinazoline. InChIKey: TUTFTLQZQHCEFU-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 4-(bromomethyl)-6,7-dimethoxyquinazoline |
| InChIKey | TUTFTLQZQHCEFU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)CBr)OC |
Computed by PubChem (NCBI)