Products 1036000-39-1
CAS 1036000-39-1 is the registry number for ethyl 5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 500mg, 5g.
Ethyl 3-(5-methylfuran-2-yl)-1H-pyrazole-5-carboxylate (CAS 1036000-39-1) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: ethyl 3-(5-methylfuran-2-yl)-1H-pyrazole-5-carboxylate. InChIKey: YFKITICHACVSCW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | ethyl 3-(5-methylfuran-2-yl)-1H-pyrazole-5-carboxylate |
| InChIKey | YFKITICHACVSCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C2=CC=C(O2)C |
Computed by PubChem (NCBI)