CAS 1036466-75-7 is the registry number for N-Benzyl-2,2-difluoro-2h-1,3-benzodioxol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-benzyl-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1036466-75-7) is a chemical compound with the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. IUPAC name: N-benzyl-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: SHULVINDYCZWLQ-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO2 |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | N-benzyl-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | SHULVINDYCZWLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)