Products 303794-31-2
CAS 303794-31-2 is the registry number for N-(2,4-difluorophenyl)-2-phenoxyethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2,4-difluorophenyl)-2-phenoxyacetamide (CAS 303794-31-2) is a chemical compound with the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2-phenoxyacetamide. InChIKey: FKDOHHOBZNICRD-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO2 |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2-phenoxyacetamide |
| InChIKey | FKDOHHOBZNICRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)