CAS 1896790-23-0 is the registry number for 4-(2,2-Difluoro-benzo[1,3]dioxol-5-yl)-benzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]methanamine (CAS 1896790-23-0) is a chemical compound with the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. IUPAC name: [4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]methanamine. InChIKey: FSOCEOZRYRWLPJ-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO2 |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | [4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]methanamine |
| InChIKey | FSOCEOZRYRWLPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)