CAS 1210419-53-6 is the registry number for 6-(3-Ethyl-2,6-difluorophenyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxylic acid (CAS 1210419-53-6) is a chemical compound with the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. IUPAC name: 6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxylic acid. InChIKey: DSYRMMIOQWINTD-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO2 |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | 6-(3-ethyl-2,6-difluorophenyl)pyridine-2-carboxylic acid |
| InChIKey | DSYRMMIOQWINTD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)F)C2=NC(=CC=C2)C(=O)O)F |
Computed by PubChem (NCBI)