Products 1036525-74-2
CAS 1036525-74-2 is the registry number for {4-[(piperidine-1-sulfonyl)methyl]phenyl}methanamine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-(piperidin-1-ylsulfonylmethyl)phenyl]methanamine (CAS 1036525-74-2) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: [4-(piperidin-1-ylsulfonylmethyl)phenyl]methanamine. InChIKey: OYXKNMUWTZQUCG-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | [4-(piperidin-1-ylsulfonylmethyl)phenyl]methanamine |
| InChIKey | OYXKNMUWTZQUCG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)CC2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)