Products 1036549-48-0
CAS 1036549-48-0 is the registry number for 2-((3-Cyanophenyl)methanesulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(3-cyanophenyl)methylsulfonyl]benzoic acid (CAS 1036549-48-0) is a chemical compound with the molecular formula C15H11NO4S and a molecular weight of 301.3 g/mol. IUPAC name: 2-[(3-cyanophenyl)methylsulfonyl]benzoic acid. InChIKey: FRFPVSULJOMVDY-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4S |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 2-[(3-cyanophenyl)methylsulfonyl]benzoic acid |
| InChIKey | FRFPVSULJOMVDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)CC2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)