CAS 1356470-08-0 appears in our catalog under these names: 1-Benzenesulfonyl-1H-indole-4-carboxylic acid, 98%, 1-(Phenylsulfonyl)-1H-indole-4-carboxylic acid, 97%, 1–(Phenylsulfonyl)–1H–indole–4–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
1-(benzenesulfonyl)indole-4-carboxylic acid (CAS 1356470-08-0) is a chemical compound with the molecular formula C15H11NO4S and a molecular weight of 301.3 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-4-carboxylic acid. InChIKey: SHPJYYCONNJVMZ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4S |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-4-carboxylic acid |
| InChIKey | SHPJYYCONNJVMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CC=C32)C(=O)O |
Computed by PubChem (NCBI)