CAS 40899-93-2 is the registry number for 1-(Phenylsulfonyl)-1H-indole-2-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
1-(benzenesulfonyl)indole-2-carboxylic acid (CAS 40899-93-2) is a chemical compound with the molecular formula C15H11NO4S and a molecular weight of 301.3 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-2-carboxylic acid. InChIKey: QIWDUGKJAHJRAE-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4S |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-2-carboxylic acid |
| InChIKey | QIWDUGKJAHJRAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2C(=O)O |
Computed by PubChem (NCBI)