Products 40899-93-2

CAS 40899-93-2 is the registry number for 1-(Phenylsulfonyl)-1H-indole-2-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(benzenesulfonyl)indole-2-carboxylic acid (CAS 40899-93-2) is a chemical compound with the molecular formula C15H11NO4S and a molecular weight of 301.3 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-2-carboxylic acid. InChIKey: QIWDUGKJAHJRAE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO4S
Molecular weight301.3 g/mol
IUPAC name1-(benzenesulfonyl)indole-2-carboxylic acid
InChIKeyQIWDUGKJAHJRAE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3C=C2C(=O)O

Computed by PubChem (NCBI)