CAS 278593-17-2 appears in our catalog under these names: 1-(Phenylsulfonyl)-1h-indole-3-carboxylic acid, 95%, 1-(Phenylsulfonyl)-1H-indole-3-carboxylic acid, 95+%, 1-(Phenylsulfonyl)-1H-indole-3-carboxylic acid, 95%+, 95%+, 1-(Phenylsulfonyl)-1H-indole-3-carboxylic acid, 95%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(benzenesulfonyl)indole-3-carboxylic acid (CAS 278593-17-2) is a chemical compound with the molecular formula C15H11NO4S and a molecular weight of 301.3 g/mol. IUPAC name: 1-(benzenesulfonyl)indole-3-carboxylic acid. InChIKey: ISTBYLZYNVIQFS-UHFFFAOYSA-N.
| Molecular formula | C15H11NO4S |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 1-(benzenesulfonyl)indole-3-carboxylic acid |
| InChIKey | ISTBYLZYNVIQFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)