Products 1036760-03-8
CAS 1036760-03-8 appears in our catalog under these names: (3-(1-Hydroxyethyl)phenyl)boronic acid, 97%, (3-(1-Hydroxyethyl)phenyl)boronic acid, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
[3-(1-hydroxyethyl)phenyl]boronic acid (CAS 1036760-03-8) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: [3-(1-hydroxyethyl)phenyl]boronic acid. InChIKey: HMEWBULOTJOSEI-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | [3-(1-hydroxyethyl)phenyl]boronic acid |
| InChIKey | HMEWBULOTJOSEI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(C)O)(O)O |
Computed by PubChem (NCBI)