Products 1037061-95-2
CAS 1037061-95-2 appears in our catalog under these names: 3-Cyclohexyl-1H-pyrazole-5-carboxylic acid, 95%, 3-Cyclohexyl-1H-pyrazole-5-carboxylic acid. Offered by: Ambeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
5-cyclohexyl-1H-pyrazole-3-carboxylic acid (CAS 1037061-95-2) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-cyclohexyl-1H-pyrazole-3-carboxylic acid. InChIKey: UZBZBNDRCGYRRL-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-cyclohexyl-1H-pyrazole-3-carboxylic acid |
| InChIKey | UZBZBNDRCGYRRL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC(=NN2)C(=O)O |
Computed by PubChem (NCBI)