CAS 1037152-84-3 appears in our catalog under these names: 2-Chloro-1-{1H-pyrrolo(2,3-b)pyridin-3-yl}propan-1-one, 95%, 2-Chloro-1-{1H-pyrrolo(2,3-b)pyridin-3-yl}propan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one (CAS 1037152-84-3) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one. InChIKey: GIIPPRSBUWRMAQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-chloro-1-(1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one |
| InChIKey | GIIPPRSBUWRMAQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CNC2=C1C=CC=N2)Cl |
Computed by PubChem (NCBI)