CAS 196301-93-6 is the registry number for 3-(4-Chlorophenyl)-5-ethyl-1,2,4-oxadiazole, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 500g, 1g.
3-(4-chlorophenyl)-5-ethyl-1,2,4-oxadiazole (CAS 196301-93-6) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 3-(4-chlorophenyl)-5-ethyl-1,2,4-oxadiazole. InChIKey: PLPLVENHKIILDV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5-ethyl-1,2,4-oxadiazole |
| InChIKey | PLPLVENHKIILDV-UHFFFAOYSA-N |
| SMILES | CCC1=NC(=NO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)