CAS 1694855-13-4 is the registry number for 2-Chloro-4-(imidazol-1-yl)benzyl alcohol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2-chloro-4-imidazol-1-ylphenyl)methanol (CAS 1694855-13-4) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: (2-chloro-4-imidazol-1-ylphenyl)methanol. InChIKey: LVPPYUHSGBSFHZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | (2-chloro-4-imidazol-1-ylphenyl)methanol |
| InChIKey | LVPPYUHSGBSFHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=CN=C2)Cl)CO |
Computed by PubChem (NCBI)