CAS 2193058-85-2 is the registry number for 2-(1H-Pyrazol-1-yl)benzaldehyde hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-pyrazol-1-ylbenzaldehyde;hydrochloride (CAS 2193058-85-2) is a chemical compound with the molecular formula C10H9ClN2O and a molecular weight of 208.64 g/mol. IUPAC name: 2-pyrazol-1-ylbenzaldehyde;hydrochloride. InChIKey: UVDUPXQTSNKJBB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-pyrazol-1-ylbenzaldehyde;hydrochloride |
| InChIKey | UVDUPXQTSNKJBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)N2C=CC=N2.Cl |
Computed by PubChem (NCBI)