CAS 103742-39-8 appears in our catalog under these names: Methyl 5-amino-1-benzyl-1h-1,2,3-triazole-4-carboxylate, 95%, Methyl 5-amino-1-benzyl-1H-1,2,3-triazole-4-carboxylate, 90%, Methyl 5-amino-1-benzyl-1H-1,2,3-triazole-4-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
Methyl 5-amino-1-benzyltriazole-4-carboxylate (CAS 103742-39-8) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: methyl 5-amino-1-benzyltriazole-4-carboxylate. InChIKey: MJWNUBRBZBLGOM-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | methyl 5-amino-1-benzyltriazole-4-carboxylate |
| InChIKey | MJWNUBRBZBLGOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)