Products 565192-00-9
CAS 565192-00-9 appears in our catalog under these names: 3-Ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid hydrazide, 95%, 3-Ethyl-4-oxo-3,4-dihydrophthalazine-1-carbohydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-ethyl-4-oxophthalazine-1-carbohydrazide (CAS 565192-00-9) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: 3-ethyl-4-oxophthalazine-1-carbohydrazide. InChIKey: SMNBYAWGLAGBJB-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 3-ethyl-4-oxophthalazine-1-carbohydrazide |
| InChIKey | SMNBYAWGLAGBJB-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=CC=CC=C2C(=N1)C(=O)NN |
Computed by PubChem (NCBI)