Products 1774900-65-0
CAS 1774900-65-0 is the registry number for 5-[(3,5-Dimethyl-1h-pyrazol-1-yl)carbonyl]-2-methoxypyrimidine, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3,5-dimethylpyrazol-1-yl)-(2-methoxypyrimidin-5-yl)methanone (CAS 1774900-65-0) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: (3,5-dimethylpyrazol-1-yl)-(2-methoxypyrimidin-5-yl)methanone. InChIKey: SQHADESFFUADJZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | (3,5-dimethylpyrazol-1-yl)-(2-methoxypyrimidin-5-yl)methanone |
| InChIKey | SQHADESFFUADJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=O)C2=CN=C(N=C2)OC)C |
Computed by PubChem (NCBI)