CAS 401623-14-1 is the registry number for N-[(5-Amino-1,3,4-oxadiazol-2-yl)methyl]-N-methylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-amino-1,3,4-oxadiazol-2-yl)methyl]-N-methylbenzamide (CAS 401623-14-1) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: N-[(5-amino-1,3,4-oxadiazol-2-yl)methyl]-N-methylbenzamide. InChIKey: HLXZNIGFDAXJPD-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | N-[(5-amino-1,3,4-oxadiazol-2-yl)methyl]-N-methylbenzamide |
| InChIKey | HLXZNIGFDAXJPD-UHFFFAOYSA-N |
| SMILES | CN(CC1=NN=C(O1)N)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)