CAS 103775-61-7 appears in our catalog under these names: (R)-2-Hydroxypropyl 4-methylbenzenesulfonate 98%, (R)-2-hydroxypropyl 4-methylbenzenesulfonate, 98%, 98%, (R)-2-hydroxypropyl 4-methylbenzenesulfonate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2R)-2-hydroxypropyl] 4-methylbenzenesulfonate (CAS 103775-61-7) is a chemical compound with the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. IUPAC name: [(2R)-2-hydroxypropyl] 4-methylbenzenesulfonate. InChIKey: ZRLDVMGSMOLUOJ-SECBINFHSA-N.
| Molecular formula | C10H14O4S |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | [(2R)-2-hydroxypropyl] 4-methylbenzenesulfonate |
| InChIKey | ZRLDVMGSMOLUOJ-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](C)O |
Computed by PubChem (NCBI)